C29H24N2O3S — CID 5071443
(3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 2-ethoxynaphthalene-1-carboxylate (PubChem CID 5071443) has the molecular formula C29H24N2O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 2-ethoxynaphthalene-1-carboxylate.
| Compound Name | (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 2-ethoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 5071443 |
| Molecular Formula | C29H24N2O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 2-ethoxynaphthalene-1-carboxylate |
| SMILES | CCOc1ccc2ccccc2c1C(=O)Oc1c(Sc2ccccc2)c(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C29H24N2O3S/c1-3-33-25-19-18-21-12-10-11-17-24(21)26(25)29(32)34-28-27(35-23-15-8-5-9-16-23)20(2)30-31(28)22-13-6-4-7-14-22/h4-19H,3H2,1-2H3 |
| InChIKey | WWLZPFGYYQGSOQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |