C25H28N2O2S — CID 5071444
(3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 3-cyclohexylpropanoate (PubChem CID 5071444) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 3-cyclohexylpropanoate.
| Compound Name | (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 5071444 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (3-methyl-1-phenyl-4-phenylsulfanylpyrazol-5-yl) 3-cyclohexylpropanoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)CCC2CCCCC2)c1Sc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-19-24(30-22-15-9-4-10-16-22)25(27(26-19)21-13-7-3-8-14-21)29-23(28)18-17-20-11-5-2-6-12-20/h3-4,7-10,13-16,20H,2,5-6,11-12,17-18H2,1H3 |
| InChIKey | ZKDMJZZESCUGLW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |