C25H21ClN2O2S — CID 2153735
[4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 3-phenylpropanoate (PubChem CID 2153735) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 3-phenylpropanoate.
| Compound Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 2153735 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [4-(4-chlorophenyl)sulfanyl-3-methyl-1-phenylpyrazol-5-yl] 3-phenylpropanoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)CCc2ccccc2)c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O2S/c1-18-24(31-22-15-13-20(26)14-16-22)25(28(27-18)21-10-6-3-7-11-21)30-23(29)17-12-19-8-4-2-5-9-19/h2-11,13-16H,12,17H2,1H3 |
| InChIKey | XLGCJHOCEFTIFQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |