C19H13F5N2O3S — CID 2153758
[3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-methoxyacetate (PubChem CID 2153758) has the molecular formula C19H13F5N2O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-methoxyacetate.
| Compound Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 2153758 |
| Molecular Formula | C19H13F5N2O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-methoxyacetate |
| SMILES | COCC(=O)Oc1c(Sc2c(F)c(F)c(F)c(F)c2F)c(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H13F5N2O3S/c1-9-17(30-18-15(23)13(21)12(20)14(22)16(18)24)19(29-11(27)8-28-2)26(25-9)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3 |
| InChIKey | QLTVXBKRRUTEJG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|