About [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate
[3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 4282578) has the molecular formula C24H17Cl2N3O5S
and a molecular weight of 530.39 g/mol. Its IUPAC name is [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate.
Molecular Properties
| Compound Name | [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
| PubChem CID | 4282578 |
| Molecular Formula | C24H17Cl2N3O5S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)COc2ccc(Cl)cc2Cl)c1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H17Cl2N3O5S/c1-15-23(35-21-10-6-5-9-19(21)29(31)32)24(28(27-15)17-7-3-2-4-8-17)34-22(30)14-33-20-12-11-16(25)13-18(20)26/h2-13H,14H2,1H3 |
| InChIKey | YBLXMQKTHFDRQJ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate?
The IUPAC name of [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate (CID 4282578) is [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate.
What is the SMILES notation for [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate?
The canonical SMILES for [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate is Cc1nn(-c2ccccc2)c(OC(=O)COc2ccc(Cl)cc2Cl)c1Sc1ccccc1[N+](=O)[O-].
What is the InChIKey of [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate?
The InChIKey is YBLXMQKTHFDRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2N3O5S/c1-15-23(35-21-10-6-5-9-19(21)29(31)32)24(28(27-15)17-7-3-2-4-8-17)34-22(30)14-33-20-12-11-16(25)13-18(20)26/h2-13H,14H2,1H3.
What are the key properties of [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate?
[3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate has a molecular weight of 530.39 g/mol, XLogP of 6.53, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate is sourced from PubChem (CID 4282578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).