C24H17Cl2N3O5S — CID 4282578
[3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 4282578) has the molecular formula C24H17Cl2N3O5S and a molecular weight of 530.39 g/mol. Its IUPAC name is [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 4282578 |
| Molecular Formula | C24H17Cl2N3O5S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | [3-methyl-4-(2-nitrophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)COc2ccc(Cl)cc2Cl)c1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H17Cl2N3O5S/c1-15-23(35-21-10-6-5-9-19(21)29(31)32)24(28(27-15)17-7-3-2-4-8-17)34-22(30)14-33-20-12-11-16(25)13-18(20)26/h2-13H,14H2,1H3 |
| InChIKey | YBLXMQKTHFDRQJ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|