C24H17Cl2N3O7S — CID 5199160
[3-methyl-4-(4-nitrophenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 5199160) has the molecular formula C24H17Cl2N3O7S and a molecular weight of 562.39 g/mol. Its IUPAC name is [3-methyl-4-(4-nitrophenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [3-methyl-4-(4-nitrophenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 5199160 |
| Molecular Formula | C24H17Cl2N3O7S |
| Molecular Weight | 562.39 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | [3-methyl-4-(4-nitrophenyl)sulfonyl-1-phenylpyrazol-5-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)COc2ccc(Cl)cc2Cl)c1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17Cl2N3O7S/c1-15-23(37(33,34)19-10-8-18(9-11-19)29(31)32)24(28(27-15)17-5-3-2-4-6-17)36-22(30)14-35-21-12-7-16(25)13-20(21)26/h2-13H,14H2,1H3 |
| InChIKey | NCNCENHNJUPMEK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 130.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|