C25H22N2O3S — CID 2153752
[3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenoxyacetate (PubChem CID 2153752) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenoxyacetate.
| Compound Name | [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 2153752 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenoxyacetate |
| SMILES | Cc1ccc(Sc2c(C)nn(-c3ccccc3)c2OC(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O3S/c1-18-13-15-22(16-14-18)31-24-19(2)26-27(20-9-5-3-6-10-20)25(24)30-23(28)17-29-21-11-7-4-8-12-21/h3-16H,17H2,1-2H3 |
| InChIKey | YANFVQJTWNCUQJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |