About [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate
[3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate (PubChem CID 4100724) has the molecular formula C24H19N3O4S
and a molecular weight of 445.50 g/mol. Its IUPAC name is [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate.
Molecular Properties
| Compound Name | [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate |
| PubChem CID | 4100724 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate |
| SMILES | Cc1ccc(Sc2c(C)nn(-c3ccccc3)c2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-16-8-14-21(15-9-16)32-22-17(2)25-26(19-6-4-3-5-7-19)23(22)31-24(28)18-10-12-20(13-11-18)27(29)30/h3-15H,1-2H3 |
| InChIKey | HQNSDQCXRQUULZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate?
The IUPAC name of [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate (CID 4100724) is [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate.
What is the SMILES notation for [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate?
The canonical SMILES for [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate is Cc1ccc(Sc2c(C)nn(-c3ccccc3)c2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate?
The InChIKey is HQNSDQCXRQUULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O4S/c1-16-8-14-21(15-9-16)32-22-17(2)25-26(19-6-4-3-5-7-19)23(22)31-24(28)18-10-12-20(13-11-18)27(29)30/h3-15H,1-2H3.
What are the key properties of [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate?
[3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate has a molecular weight of 445.50 g/mol, XLogP of 5.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(4-methylphenyl)sulfanyl-1-phenylpyrazol-5-yl] 4-nitrobenzoate is sourced from PubChem (CID 4100724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).