C33H24F3N5O7 — CID 135029561
[3-methyl-1-phenyl-4-[1,1,1-trifluoro-3-[(4-nitrobenzoyl)amino]-2-phenylpropan-2-yl]pyrazol-5-yl] 4-nitrobenzoate (PubChem CID 135029561) has the molecular formula C33H24F3N5O7 and a molecular weight of 659.58 g/mol. Its IUPAC name is [3-methyl-1-phenyl-4-[1,1,1-trifluoro-3-[(4-nitrobenzoyl)amino]-2-phenylpropan-2-yl]pyrazol-5-yl] 4-nitrobenzoate.
| Compound Name | [3-methyl-1-phenyl-4-[1,1,1-trifluoro-3-[(4-nitrobenzoyl)amino]-2-phenylpropan-2-yl]pyrazol-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 135029561 |
| Molecular Formula | C33H24F3N5O7 |
| Molecular Weight | 659.58 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | [3-methyl-1-phenyl-4-[1,1,1-trifluoro-3-[(4-nitrobenzoyl)amino]-2-phenylpropan-2-yl]pyrazol-5-yl] 4-nitrobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)c2ccc([N+](=O)[O-])cc2)c1C(CNC(=O)c1ccc([N+](=O)[O-])cc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H24F3N5O7/c1-21-28(30(39(38-21)25-10-6-3-7-11-25)48-31(43)23-14-18-27(19-15-23)41(46)47)32(33(34,35)36,24-8-4-2-5-9-24)20-37-29(42)22-12-16-26(17-13-22)40(44)45/h2-19H,20H2,1H3,(H,37,42) |
| InChIKey | YNXCWZFCFXABAY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 159.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|