C23H12ClF5N2O2S — CID 4231569
[3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-chlorobenzoate (PubChem CID 4231569) has the molecular formula C23H12ClF5N2O2S and a molecular weight of 510.87 g/mol. Its IUPAC name is [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-chlorobenzoate.
| Compound Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4231569 |
| Molecular Formula | C23H12ClF5N2O2S |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-chlorobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)c2ccccc2Cl)c1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H12ClF5N2O2S/c1-11-20(34-21-18(28)16(26)15(25)17(27)19(21)29)22(31(30-11)12-7-3-2-4-8-12)33-23(32)13-9-5-6-10-14(13)24/h2-10H,1H3 |
| InChIKey | XSIMHIOHVMFDNA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|