C21H21ClN2O2S — CID 3535806
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-chlorobenzoate (PubChem CID 3535806) has the molecular formula C21H21ClN2O2S and a molecular weight of 400.93 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-chlorobenzoate.
| Compound Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-chlorobenzoate |
|---|---|
| PubChem CID | 3535806 |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-chlorobenzoate |
| SMILES | Cc1nn(C(C)(C)C)c(OC(=O)c2ccccc2Cl)c1Sc1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O2S/c1-14-18(27-15-10-6-5-7-11-15)19(24(23-14)21(2,3)4)26-20(25)16-12-8-9-13-17(16)22/h5-13H,1-4H3 |
| InChIKey | BKYDSJAQBLUQEB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |