C22H23BrN2O2S — CID 2153860
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] 4-bromobenzoate (PubChem CID 2153860) has the molecular formula C22H23BrN2O2S and a molecular weight of 459.41 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] 4-bromobenzoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2153860 |
| Molecular Formula | C22H23BrN2O2S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfanylpyrazol-5-yl] 4-bromobenzoate |
| SMILES | Cc1ccc(Sc2c(C)nn(C(C)(C)C)c2OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H23BrN2O2S/c1-14-6-12-18(13-7-14)28-19-15(2)24-25(22(3,4)5)20(19)27-21(26)16-8-10-17(23)11-9-16/h6-13H,1-5H3 |
| InChIKey | ZZOGXKVYZAIHLD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |