C23H26N2O4S — CID 3538110
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-methylbenzoate (PubChem CID 3538110) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-methylbenzoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 3538110 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(S(=O)(=O)c3ccc(C)cc3)c(C)nn2C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-15-7-11-18(12-8-15)22(26)29-21-20(17(3)24-25(21)23(4,5)6)30(27,28)19-13-9-16(2)10-14-19/h7-14H,1-6H3 |
| InChIKey | TUDMMUSRQCKXES-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |