C23H32N2O4S — CID 5175265
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3-cyclopentylpropanoate (PubChem CID 5175265) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3-cyclopentylpropanoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 5175265 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3-cyclopentylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(C(C)(C)C)c2OC(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O4S/c1-16-10-13-19(14-11-16)30(27,28)21-17(2)24-25(23(3,4)5)22(21)29-20(26)15-12-18-8-6-7-9-18/h10-11,13-14,18H,6-9,12,15H2,1-5H3 |
| InChIKey | OTYYFEWEWCEXQL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |