C22H23N3O6S — CID 3286721
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-nitrobenzoate (PubChem CID 3286721) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-nitrobenzoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3286721 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 4-nitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(C(C)(C)C)c2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-14-6-12-18(13-7-14)32(29,30)19-15(2)23-24(22(3,4)5)20(19)31-21(26)16-8-10-17(11-9-16)25(27)28/h6-13H,1-5H3 |
| InChIKey | DQCAJGQVFPUYOZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|