About [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate
[1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate (PubChem CID 3617404) has the molecular formula C24H27ClN2O2S
and a molecular weight of 443.01 g/mol. Its IUPAC name is [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate.
Molecular Properties
| Compound Name | [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate |
| PubChem CID | 3617404 |
| Molecular Formula | C24H27ClN2O2S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)Oc1c(Sc2ccc(Cl)cc2)c(C)nn1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O2S/c1-6-20(17-10-8-7-9-11-17)23(28)29-22-21(16(2)26-27(22)24(3,4)5)30-19-14-12-18(25)13-15-19/h7-15,20H,6H2,1-5H3 |
| InChIKey | YIFWHPFGPFZDRY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate?
The IUPAC name of [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate (CID 3617404) is [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate.
What is the SMILES notation for [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate?
The canonical SMILES for [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate is CCC(C(=O)Oc1c(Sc2ccc(Cl)cc2)c(C)nn1C(C)(C)C)c1ccccc1.
What is the InChIKey of [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate?
The InChIKey is YIFWHPFGPFZDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClN2O2S/c1-6-20(17-10-8-7-9-11-17)23(28)29-22-21(16(2)26-27(22)24(3,4)5)30-19-14-12-18(25)13-15-19/h7-15,20H,6H2,1-5H3.
What are the key properties of [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate?
[1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate has a molecular weight of 443.01 g/mol, XLogP of 6.85, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate is sourced from PubChem (CID 3617404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).