C24H27ClN2O2S — CID 3617404
[1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate (PubChem CID 3617404) has the molecular formula C24H27ClN2O2S and a molecular weight of 443.01 g/mol. Its IUPAC name is [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate.
| Compound Name | [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 3617404 |
| Molecular Formula | C24H27ClN2O2S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [1-tert-butyl-4-(4-chlorophenyl)sulfanyl-3-methylpyrazol-5-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)Oc1c(Sc2ccc(Cl)cc2)c(C)nn1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O2S/c1-6-20(17-10-8-7-9-11-17)23(28)29-22-21(16(2)26-27(22)24(3,4)5)30-19-14-12-18(25)13-15-19/h7-15,20H,6H2,1-5H3 |
| InChIKey | YIFWHPFGPFZDRY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |