C29H25F5N2O5S — CID 4624494
[3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 3,4,5-triethoxybenzoate (PubChem CID 4624494) has the molecular formula C29H25F5N2O5S and a molecular weight of 608.59 g/mol. Its IUPAC name is [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 4624494 |
| Molecular Formula | C29H25F5N2O5S |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)Oc2c(Sc3c(F)c(F)c(F)c(F)c3F)c(C)nn2-c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H25F5N2O5S/c1-5-38-18-13-16(14-19(39-6-2)25(18)40-7-3)29(37)41-28-26(15(4)35-36(28)17-11-9-8-10-12-17)42-27-23(33)21(31)20(30)22(32)24(27)34/h8-14H,5-7H2,1-4H3 |
| InChIKey | CPGOOONKIUFTQT-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|