C27H23F5N2O3S — CID 3499730
[1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 2-ethoxynaphthalene-1-carboxylate (PubChem CID 3499730) has the molecular formula C27H23F5N2O3S and a molecular weight of 550.55 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 2-ethoxynaphthalene-1-carboxylate.
| Compound Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 2-ethoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3499730 |
| Molecular Formula | C27H23F5N2O3S |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 2-ethoxynaphthalene-1-carboxylate |
| SMILES | CCOc1ccc2ccccc2c1C(=O)Oc1c(Sc2c(F)c(F)c(F)c(F)c2F)c(C)nn1C(C)(C)C |
| InChI | InChI=1S/C27H23F5N2O3S/c1-6-36-16-12-11-14-9-7-8-10-15(14)17(16)26(35)37-25-23(13(2)33-34(25)27(3,4)5)38-24-21(31)19(29)18(28)20(30)22(24)32/h7-12H,6H2,1-5H3 |
| InChIKey | BODWHGXJGHQGAJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|