C25H25F5N2O4S — CID 4170577
[1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 3,4-diethoxybenzoate (PubChem CID 4170577) has the molecular formula C25H25F5N2O4S and a molecular weight of 544.54 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 3,4-diethoxybenzoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 4170577 |
| Molecular Formula | C25H25F5N2O4S |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2c(Sc3c(F)c(F)c(F)c(F)c3F)c(C)nn2C(C)(C)C)cc1OCC |
| InChI | InChI=1S/C25H25F5N2O4S/c1-7-34-14-10-9-13(11-15(14)35-8-2)24(33)36-23-21(12(3)31-32(23)25(4,5)6)37-22-19(29)17(27)16(26)18(28)20(22)30/h9-11H,7-8H2,1-6H3 |
| InChIKey | LCYMQTMWUUORRY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|