C21H15ClF5N3O4S — CID 4084684
[1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 5-chloro-2-nitrobenzoate (PubChem CID 4084684) has the molecular formula C21H15ClF5N3O4S and a molecular weight of 535.88 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 5-chloro-2-nitrobenzoate.
| Compound Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 4084684 |
| Molecular Formula | C21H15ClF5N3O4S |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrazol-5-yl] 5-chloro-2-nitrobenzoate |
| SMILES | Cc1nn(C(C)(C)C)c(OC(=O)c2cc(Cl)ccc2[N+](=O)[O-])c1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H15ClF5N3O4S/c1-8-17(35-18-15(26)13(24)12(23)14(25)16(18)27)19(29(28-8)21(2,3)4)34-20(31)10-7-9(22)5-6-11(10)30(32)33/h5-7H,1-4H3 |
| InChIKey | NPEHUIGRBSQLTK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|