C20H23FN6 — CID 146424750
3-(4-amino-2-fluorophenyl)-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 146424750) has the molecular formula C20H23FN6 and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(4-amino-2-fluorophenyl)-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-(4-amino-2-fluorophenyl)-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 146424750 |
| Molecular Formula | C20H23FN6 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3-(4-amino-2-fluorophenyl)-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CN1CCC(n2cc(-c3cnc(N)c(-c4ccc(N)cc4F)c3)cn2)CC1 |
| InChI | InChI=1S/C20H23FN6/c1-26-6-4-16(5-7-26)27-12-14(11-25-27)13-8-18(20(23)24-10-13)17-3-2-15(22)9-19(17)21/h2-3,8-12,16H,4-7,22H2,1H3,(H2,23,24) |
| InChIKey | ICASIFZZJPWDLV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|