C9H18O3 — CID 14642489
trans-(1R,3R)-2-propan-2-yloxycyclohexane-1,3-diol (PubChem CID 14642489) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is trans-(1R,3R)-2-propan-2-yloxycyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-2-propan-2-yloxycyclohexane-1,3-diol |
|---|---|
| PubChem CID | 14642489 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | trans-(1R,3R)-2-propan-2-yloxycyclohexane-1,3-diol |
| SMILES | CC(C)OC1[C@H](O)CCC[C@H]1O |
| InChI | InChI=1S/C9H18O3/c1-6(2)12-9-7(10)4-3-5-8(9)11/h6-11H,3-5H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | GCVNMCQJLKSWIC-HTQZYQBOSA-N |
| XLogP | 0.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |