C8H3Cl2F3N4 — CID 146424986
1-[2,4-dichloro-3-(trifluoromethyl)phenyl]tetrazole (PubChem CID 146424986) has the molecular formula C8H3Cl2F3N4 and a molecular weight of 283.04 g/mol. Its IUPAC name is 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]tetrazole.
| Compound Name | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]tetrazole |
|---|---|
| PubChem CID | 146424986 |
| Molecular Formula | C8H3Cl2F3N4 |
| Molecular Weight | 283.04 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]tetrazole |
| SMILES | FC(F)(F)c1c(Cl)ccc(-n2cnnn2)c1Cl |
| InChI | InChI=1S/C8H3Cl2F3N4/c9-4-1-2-5(17-3-14-15-16-17)7(10)6(4)8(11,12)13/h1-3H |
| InChIKey | JLPCBNBNAWIOJH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |