C8H5ClF3N5 — CID 79506304
1-[2-chloro-5-(trifluoromethyl)phenyl]tetrazol-5-amine (PubChem CID 79506304) has the molecular formula C8H5ClF3N5 and a molecular weight of 263.61 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]tetrazol-5-amine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 79506304 |
| Molecular Formula | C8H5ClF3N5 |
| Molecular Weight | 263.61 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]tetrazol-5-amine |
| SMILES | Nc1nnnn1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C8H5ClF3N5/c9-5-2-1-4(8(10,11)12)3-6(5)17-7(13)14-15-16-17/h1-3H,(H2,13,14,16) |
| InChIKey | NSLIJYWAMSISSY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |