5-fluoro-6-methylpyridine-2-sulfonyl chloride

C6H5ClFNO2S — CID 146425369

IUPAC5-fluoro-6-methylpyridine-2-sulfonyl chloride
SMILESCc1nc(S(=O)(=O)Cl)ccc1F
InChIInChI=1S/C6H5ClFNO2S/c1-4-5(8)2-3-6(9-4)12(7,10)11/h2-3H,1H3
InChIKeyLPMOWDZSFJKWJK-UHFFFAOYSA-N
MW209.63 g/mol
LogP1.46
Rot. Bonds1

About 5-fluoro-6-methylpyridine-2-sulfonyl chloride

5-fluoro-6-methylpyridine-2-sulfonyl chloride (PubChem CID 146425369) has the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. Its IUPAC name is 5-fluoro-6-methylpyridine-2-sulfonyl chloride.

Molecular Properties

Compound Name5-fluoro-6-methylpyridine-2-sulfonyl chloride
PubChem CID146425369
Molecular FormulaC6H5ClFNO2S
Molecular Weight209.63 g/mol
Exact Mass208.97
IUPAC Name5-fluoro-6-methylpyridine-2-sulfonyl chloride
SMILESCc1nc(S(=O)(=O)Cl)ccc1F
InChIInChI=1S/C6H5ClFNO2S/c1-4-5(8)2-3-6(9-4)12(7,10)11/h2-3H,1H3
InChIKeyLPMOWDZSFJKWJK-UHFFFAOYSA-N
XLogP1.46
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.63
LogP ≤ 51.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-fluoro-6-methylpyridine-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-6-methylpyridine-2-sulfonyl chloride?
The IUPAC name of 5-fluoro-6-methylpyridine-2-sulfonyl chloride (CID 146425369) is 5-fluoro-6-methylpyridine-2-sulfonyl chloride.
What is the SMILES notation for 5-fluoro-6-methylpyridine-2-sulfonyl chloride?
The canonical SMILES for 5-fluoro-6-methylpyridine-2-sulfonyl chloride is Cc1nc(S(=O)(=O)Cl)ccc1F.
What is the InChIKey of 5-fluoro-6-methylpyridine-2-sulfonyl chloride?
The InChIKey is LPMOWDZSFJKWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClFNO2S/c1-4-5(8)2-3-6(9-4)12(7,10)11/h2-3H,1H3.
What are the key properties of 5-fluoro-6-methylpyridine-2-sulfonyl chloride?
5-fluoro-6-methylpyridine-2-sulfonyl chloride has a molecular weight of 209.63 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methylpyridine-2-sulfonyl chloride is sourced from PubChem (CID 146425369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).