C19H35NO2Si — CID 14642545
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-N-[(1S)-1-phenylethyl]hydroxylamine (PubChem CID 14642545) has the molecular formula C19H35NO2Si and a molecular weight of 337.58 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-N-[(1S)-1-phenylethyl]hydroxylamine.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-N-[(1S)-1-phenylethyl]hydroxylamine |
|---|---|
| PubChem CID | 14642545 |
| Molecular Formula | C19H35NO2Si |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-N-[(1S)-1-phenylethyl]hydroxylamine |
| SMILES | CC(C)[C@@H](CO[Si](C)(C)C(C)(C)C)N(O)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H35NO2Si/c1-15(2)18(14-22-23(7,8)19(4,5)6)20(21)16(3)17-12-10-9-11-13-17/h9-13,15-16,18,21H,14H2,1-8H3/t16-,18+/m0/s1 |
| InChIKey | BMCSOMHUMKOSMW-FUHWJXTLSA-N |
| XLogP | 5.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|