C16H20IN3O — CID 146428926
N-[4-[4-iodobutyl(methyl)amino]quinolin-3-yl]acetamide (PubChem CID 146428926) has the molecular formula C16H20IN3O and a molecular weight of 397.26 g/mol. Its IUPAC name is N-[4-[4-iodobutyl(methyl)amino]quinolin-3-yl]acetamide.
| Compound Name | N-[4-[4-iodobutyl(methyl)amino]quinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 146428926 |
| Molecular Formula | C16H20IN3O |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[4-[4-iodobutyl(methyl)amino]quinolin-3-yl]acetamide |
| SMILES | CC(=O)Nc1cnc2ccccc2c1N(C)CCCCI |
| InChI | InChI=1S/C16H20IN3O/c1-12(21)19-15-11-18-14-8-4-3-7-13(14)16(15)20(2)10-6-5-9-17/h3-4,7-8,11H,5-6,9-10H2,1-2H3,(H,19,21) |
| InChIKey | ABTFCGSKJLMEKT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|