C14H17N3 — CID 166969759
N-methyl-3-(methylideneamino)-N-propylquinolin-4-amine (PubChem CID 166969759) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-methyl-3-(methylideneamino)-N-propylquinolin-4-amine.
| Compound Name | N-methyl-3-(methylideneamino)-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 166969759 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N-methyl-3-(methylideneamino)-N-propylquinolin-4-amine |
| SMILES | C=Nc1cnc2ccccc2c1N(C)CCC |
| InChI | InChI=1S/C14H17N3/c1-4-9-17(3)14-11-7-5-6-8-12(11)16-10-13(14)15-2/h5-8,10H,2,4,9H2,1,3H3 |
| InChIKey | VTNGLIQRYPCYHX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|