C11H11BrN2 — CID 119086885
3-bromo-N,N-dimethylquinolin-4-amine (PubChem CID 119086885) has the molecular formula C11H11BrN2 and a molecular weight of 251.13 g/mol. Its IUPAC name is 3-bromo-N,N-dimethylquinolin-4-amine.
| Compound Name | 3-bromo-N,N-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 119086885 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-bromo-N,N-dimethylquinolin-4-amine |
| SMILES | CN(C)c1c(Br)cnc2ccccc12 |
| InChI | InChI=1S/C11H11BrN2/c1-14(2)11-8-5-3-4-6-10(8)13-7-9(11)12/h3-7H,1-2H3 |
| InChIKey | KVBWRDLCGUGOGY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |