C24H28N2 — CID 146429476
N-[(5Z)-2-(5,6-dihydro-1H-indol-3-yl)-6-methyl-4-methylideneocta-1,5-dien-3-yl]aniline (PubChem CID 146429476) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[(5Z)-2-(5,6-dihydro-1H-indol-3-yl)-6-methyl-4-methylideneocta-1,5-dien-3-yl]aniline.
| Compound Name | N-[(5Z)-2-(5,6-dihydro-1H-indol-3-yl)-6-methyl-4-methylideneocta-1,5-dien-3-yl]aniline |
|---|---|
| PubChem CID | 146429476 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[(5Z)-2-(5,6-dihydro-1H-indol-3-yl)-6-methyl-4-methylideneocta-1,5-dien-3-yl]aniline |
| SMILES | C=C(/C=C(/C)CC)C(Nc1ccccc1)C(=C)c1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C24H28N2/c1-5-17(2)15-18(3)24(26-20-11-7-6-8-12-20)19(4)22-16-25-23-14-10-9-13-21(22)23/h6-8,11-16,24-26H,3-5,9-10H2,1-2H3/b17-15- |
| InChIKey | DBCQLRMKWHGHJM-ICFOKQHNSA-N |
| XLogP | 4.78 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|