C26H25N3 — CID 146429516
4-[1-(3-methylanilino)-2-[(2E)-2-pent-4-ynylidene-1,3-dihydropyrrol-4-yl]prop-2-enyl]benzonitrile (PubChem CID 146429516) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-[1-(3-methylanilino)-2-[(2E)-2-pent-4-ynylidene-1,3-dihydropyrrol-4-yl]prop-2-enyl]benzonitrile.
| Compound Name | 4-[1-(3-methylanilino)-2-[(2E)-2-pent-4-ynylidene-1,3-dihydropyrrol-4-yl]prop-2-enyl]benzonitrile |
|---|---|
| PubChem CID | 146429516 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-[1-(3-methylanilino)-2-[(2E)-2-pent-4-ynylidene-1,3-dihydropyrrol-4-yl]prop-2-enyl]benzonitrile |
| SMILES | C#CCC/C=C1\CC(C(=C)C(Nc2cccc(C)c2)c2ccc(C#N)cc2)=CN1 |
| InChI | InChI=1S/C26H25N3/c1-4-5-6-9-24-16-23(18-28-24)20(3)26(22-13-11-21(17-27)12-14-22)29-25-10-7-8-19(2)15-25/h1,7-15,18,26,28-29H,3,5-6,16H2,2H3/b24-9+ |
| InChIKey | MLVXACDZYMDXFT-PGGKNCGUSA-N |
| XLogP | 5.75 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|