C19H20N4OS — CID 146430998
N-cyclopropyl-N-ethenyl-N'-methyl-6-(3-methyl-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyridine-2-carboximidamide (PubChem CID 146430998) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-cyclopropyl-N-ethenyl-N'-methyl-6-(3-methyl-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyridine-2-carboximidamide.
| Compound Name | N-cyclopropyl-N-ethenyl-N'-methyl-6-(3-methyl-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 146430998 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-cyclopropyl-N-ethenyl-N'-methyl-6-(3-methyl-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl)pyridine-2-carboximidamide |
| SMILES | C=CN(/C(=N\C)c1cccc(N2Cc3c(C)csc3C2=O)n1)C1CC1 |
| InChI | InChI=1S/C19H20N4OS/c1-4-22(13-8-9-13)18(20-3)15-6-5-7-16(21-15)23-10-14-12(2)11-25-17(14)19(23)24/h4-7,11,13H,1,8-10H2,2-3H3/b20-18- |
| InChIKey | WTTQMMUDYZJEIS-ZZEZOPTASA-N |
| XLogP | 3.60 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|