C24H19ClN8 — CID 146433230
4-[[5-[4-amino-3-[amino(1H-indazol-6-yl)amino]-5-chlorophenyl]pyrazol-1-yl]methyl]benzonitrile (PubChem CID 146433230) has the molecular formula C24H19ClN8 and a molecular weight of 454.93 g/mol. Its IUPAC name is 4-[[5-[4-amino-3-[amino(1H-indazol-6-yl)amino]-5-chlorophenyl]pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[4-amino-3-[amino(1H-indazol-6-yl)amino]-5-chlorophenyl]pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146433230 |
| Molecular Formula | C24H19ClN8 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-[[5-[4-amino-3-[amino(1H-indazol-6-yl)amino]-5-chlorophenyl]pyrazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2nccc2-c2cc(Cl)c(N)c(N(N)c3ccc4cn[nH]c4c3)c2)cc1 |
| InChI | InChI=1S/C24H19ClN8/c25-20-9-18(22-7-8-30-32(22)14-16-3-1-15(12-26)2-4-16)10-23(24(20)27)33(28)19-6-5-17-13-29-31-21(17)11-19/h1-11,13H,14,27-28H2,(H,29,31) |
| InChIKey | RLMULFXJOMVLNX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|