C16H31FN2O — CID 146435559
4-[[(5S)-5-tert-butyl-3-fluoro-1-propan-2-ylpyrrolidin-3-yl]methyl]morpholine (PubChem CID 146435559) has the molecular formula C16H31FN2O and a molecular weight of 286.44 g/mol. Its IUPAC name is 4-[[(5S)-5-tert-butyl-3-fluoro-1-propan-2-ylpyrrolidin-3-yl]methyl]morpholine.
| Compound Name | 4-[[(5S)-5-tert-butyl-3-fluoro-1-propan-2-ylpyrrolidin-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 146435559 |
| Molecular Formula | C16H31FN2O |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 4-[[(5S)-5-tert-butyl-3-fluoro-1-propan-2-ylpyrrolidin-3-yl]methyl]morpholine |
| SMILES | CC(C)N1CC(F)(CN2CCOCC2)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C16H31FN2O/c1-13(2)19-12-16(17,10-14(19)15(3,4)5)11-18-6-8-20-9-7-18/h13-14H,6-12H2,1-5H3/t14-,16?/m0/s1 |
| InChIKey | RHBGQFAOHVVFRA-LBAUFKAWSA-N |
| XLogP | 2.56 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |