C10H12N2 — CID 146436926
N-[1-(2,4-dimethyl-3-pyridinyl)ethenyl]methanimine (PubChem CID 146436926) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-3-pyridinyl)ethenyl]methanimine.
| Compound Name | N-[1-(2,4-dimethyl-3-pyridinyl)ethenyl]methanimine |
|---|---|
| PubChem CID | 146436926 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-[1-(2,4-dimethyl-3-pyridinyl)ethenyl]methanimine |
| SMILES | C=NC(=C)c1c(C)ccnc1C |
| InChI | InChI=1S/C10H12N2/c1-7-5-6-12-9(3)10(7)8(2)11-4/h5-6H,2,4H2,1,3H3 |
| InChIKey | VPDKDURKJHBOHH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|