C21H12F4N4O2S — CID 146438895
1-(3H-benzimidazol-5-yl)-5-[2-fluoro-4-[5-(trifluoromethyl)thiophen-2-yl]phenyl]imidazolidine-2,4-dione (PubChem CID 146438895) has the molecular formula C21H12F4N4O2S and a molecular weight of 460.41 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-[2-fluoro-4-[5-(trifluoromethyl)thiophen-2-yl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-[2-fluoro-4-[5-(trifluoromethyl)thiophen-2-yl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146438895 |
| Molecular Formula | C21H12F4N4O2S |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-[2-fluoro-4-[5-(trifluoromethyl)thiophen-2-yl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2ccc3nc[nH]c3c2)C1c1ccc(-c2ccc(C(F)(F)F)s2)cc1F |
| InChI | InChI=1S/C21H12F4N4O2S/c22-13-7-10(16-5-6-17(32-16)21(23,24)25)1-3-12(13)18-19(30)28-20(31)29(18)11-2-4-14-15(8-11)27-9-26-14/h1-9,18H,(H,26,27)(H,28,30,31) |
| InChIKey | JDUWADQPWWUFST-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|