C19H17F3N8O2 — CID 146440136
N'-[amino(2,2,2-trifluoroethyl)amino]-4-[3-(3H-benzimidazol-5-yl)-2,5-dioxoimidazolidin-4-yl]benzenecarboximidamide (PubChem CID 146440136) has the molecular formula C19H17F3N8O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is N'-[amino(2,2,2-trifluoroethyl)amino]-4-[3-(3H-benzimidazol-5-yl)-2,5-dioxoimidazolidin-4-yl]benzenecarboximidamide.
| Compound Name | N'-[amino(2,2,2-trifluoroethyl)amino]-4-[3-(3H-benzimidazol-5-yl)-2,5-dioxoimidazolidin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 146440136 |
| Molecular Formula | C19H17F3N8O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N'-[amino(2,2,2-trifluoroethyl)amino]-4-[3-(3H-benzimidazol-5-yl)-2,5-dioxoimidazolidin-4-yl]benzenecarboximidamide |
| SMILES | N/C(=N\N(N)CC(F)(F)F)c1ccc(C2C(=O)NC(=O)N2c2ccc3nc[nH]c3c2)cc1 |
| InChI | InChI=1S/C19H17F3N8O2/c20-19(21,22)8-29(24)28-16(23)11-3-1-10(2-4-11)15-17(31)27-18(32)30(15)12-5-6-13-14(7-12)26-9-25-13/h1-7,9,15H,8,24H2,(H2,23,28)(H,25,26)(H,27,31,32) |
| InChIKey | HAVSBINYJAAIMZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|