C23H17F6N3O3 — CID 123182617
1-(3H-benzimidazol-5-yl)-5-[3,5-bis(trifluoromethyl)phenyl]-4-butanoylpyrrolidine-2,3-dione (PubChem CID 123182617) has the molecular formula C23H17F6N3O3 and a molecular weight of 497.40 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-[3,5-bis(trifluoromethyl)phenyl]-4-butanoylpyrrolidine-2,3-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-[3,5-bis(trifluoromethyl)phenyl]-4-butanoylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123182617 |
| Molecular Formula | C23H17F6N3O3 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-[3,5-bis(trifluoromethyl)phenyl]-4-butanoylpyrrolidine-2,3-dione |
| SMILES | CCCC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F6N3O3/c1-2-3-17(33)18-19(11-6-12(22(24,25)26)8-13(7-11)23(27,28)29)32(21(35)20(18)34)14-4-5-15-16(9-14)31-10-30-15/h4-10,18-19H,2-3H2,1H3,(H,30,31) |
| InChIKey | NTJUEXVOMHIADF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|