C24H25N3O3 — CID 123494079
1-(3H-benzimidazol-5-yl)-4-hexanoyl-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 123494079) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-hexanoyl-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-hexanoyl-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123494079 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-hexanoyl-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1cccc(C)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-3-4-5-9-20(28)21-22(16-8-6-7-15(2)12-16)27(24(30)23(21)29)17-10-11-18-19(13-17)26-14-25-18/h6-8,10-14,21-22H,3-5,9H2,1-2H3,(H,25,26) |
| InChIKey | CFZCTCZLWPHINN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|