C20H19N3O4 — CID 123599027
1-(3H-benzimidazol-5-yl)-5-(furan-2-yl)-4-(3-methylbutanoyl)pyrrolidine-2,3-dione (PubChem CID 123599027) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-(furan-2-yl)-4-(3-methylbutanoyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-(furan-2-yl)-4-(3-methylbutanoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123599027 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-(furan-2-yl)-4-(3-methylbutanoyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)CC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1ccco1 |
| InChI | InChI=1S/C20H19N3O4/c1-11(2)8-15(24)17-18(16-4-3-7-27-16)23(20(26)19(17)25)12-5-6-13-14(9-12)22-10-21-13/h3-7,9-11,17-18H,8H2,1-2H3,(H,21,22) |
| InChIKey | OZOXJNIQWXMOQN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|