C16H13N5O3 — CID 123919281
4-acetyl-1-(3H-benzimidazol-5-yl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione (PubChem CID 123919281) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-acetyl-1-(3H-benzimidazol-5-yl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-acetyl-1-(3H-benzimidazol-5-yl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123919281 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-acetyl-1-(3H-benzimidazol-5-yl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1ccn[nH]1 |
| InChI | InChI=1S/C16H13N5O3/c1-8(22)13-14(11-4-5-19-20-11)21(16(24)15(13)23)9-2-3-10-12(6-9)18-7-17-10/h2-7,13-14H,1H3,(H,17,18)(H,19,20) |
| InChIKey | ZLAMRYZIMNBBMC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|