C18H17N5O3 — CID 123225479
1-(3H-benzimidazol-5-yl)-4-butanoyl-5-(1H-imidazol-5-yl)pyrrolidine-2,3-dione (PubChem CID 123225479) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-butanoyl-5-(1H-imidazol-5-yl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-butanoyl-5-(1H-imidazol-5-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123225479 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-butanoyl-5-(1H-imidazol-5-yl)pyrrolidine-2,3-dione |
| SMILES | CCCC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1cnc[nH]1 |
| InChI | InChI=1S/C18H17N5O3/c1-2-3-14(24)15-16(13-7-19-8-20-13)23(18(26)17(15)25)10-4-5-11-12(6-10)22-9-21-11/h4-9,15-16H,2-3H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | NRHJIVFHLAMARO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|