C9H18N2S — CID 146439857
2-propan-2-yl-7-sulfanyl-2,7-diazabicyclo[4.2.0]octane (PubChem CID 146439857) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-propan-2-yl-7-sulfanyl-2,7-diazabicyclo[4.2.0]octane.
| Compound Name | 2-propan-2-yl-7-sulfanyl-2,7-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 146439857 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-propan-2-yl-7-sulfanyl-2,7-diazabicyclo[4.2.0]octane |
| SMILES | CC(C)N1CCCC2C1CN2S |
| InChI | InChI=1S/C9H18N2S/c1-7(2)10-5-3-4-8-9(10)6-11(8)12/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | QOMWPSYEIUBKCP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|