About 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane
6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane (PubChem CID 167300749) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane.
Analyze 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane?
The IUPAC name of 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane (CID 167300749) is 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane.
What is the SMILES notation for 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane?
The canonical SMILES for 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane is CC(C)N1CCC2C1CN2C.
What is the InChIKey of 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane?
The InChIKey is RJQSBCYIGNCPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-7(2)11-5-4-8-9(11)6-10(8)3/h7-9H,4-6H2,1-3H3.
What are the key properties of 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane?
6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane has a molecular weight of 154.26 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-yl-2,6-diazabicyclo[3.2.0]heptane is sourced from PubChem (CID 167300749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).