C17H20N4O2 — CID 146441288
benzyl-[4-(tert-butyliminomethyl)pyrimidin-2-yl]carbamic acid (PubChem CID 146441288) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is benzyl-[4-(tert-butyliminomethyl)pyrimidin-2-yl]carbamic acid.
| Compound Name | benzyl-[4-(tert-butyliminomethyl)pyrimidin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146441288 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | benzyl-[4-(tert-butyliminomethyl)pyrimidin-2-yl]carbamic acid |
| SMILES | CC(C)(C)/N=C/c1ccnc(N(Cc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C17H20N4O2/c1-17(2,3)19-11-14-9-10-18-15(20-14)21(16(22)23)12-13-7-5-4-6-8-13/h4-11H,12H2,1-3H3,(H,22,23)/b19-11+ |
| InChIKey | QHDZLODTNGXNAR-YBFXNURJSA-N |
| XLogP | 3.38 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|