C31H36N6O3 — CID 146442913
ethyl 1-[2-[[(2S,6R)-4-(8-cyanoquinolin-5-yl)-6-methylmorpholin-2-yl]methyl]-1,3-dihydroisoindol-5-yl]piperazine-2-carboxylate (PubChem CID 146442913) has the molecular formula C31H36N6O3 and a molecular weight of 540.67 g/mol. Its IUPAC name is ethyl 1-[2-[[(2S,6R)-4-(8-cyanoquinolin-5-yl)-6-methylmorpholin-2-yl]methyl]-1,3-dihydroisoindol-5-yl]piperazine-2-carboxylate.
| Compound Name | ethyl 1-[2-[[(2S,6R)-4-(8-cyanoquinolin-5-yl)-6-methylmorpholin-2-yl]methyl]-1,3-dihydroisoindol-5-yl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 146442913 |
| Molecular Formula | C31H36N6O3 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | ethyl 1-[2-[[(2S,6R)-4-(8-cyanoquinolin-5-yl)-6-methylmorpholin-2-yl]methyl]-1,3-dihydroisoindol-5-yl]piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1c1ccc2c(c1)CN(C[C@H]1CN(c3ccc(C#N)c4ncccc34)C[C@@H](C)O1)C2 |
| InChI | InChI=1S/C31H36N6O3/c1-3-39-31(38)29-15-33-11-12-37(29)25-8-6-23-17-35(18-24(23)13-25)19-26-20-36(16-21(2)40-26)28-9-7-22(14-32)30-27(28)5-4-10-34-30/h4-10,13,21,26,29,33H,3,11-12,15-20H2,1-2H3/t21-,26+,29?/m1/s1 |
| InChIKey | BABRITOGYAHXSF-RPNHKFQASA-N |
| XLogP | 3.06 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|