C31H36N6O2 — CID 146275872
5-[(2R,6S)-2-methyl-6-[[8-(1,2,3,4-tetrahydroisoquinolin-6-yl)-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 146275872) has the molecular formula C31H36N6O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 5-[(2R,6S)-2-methyl-6-[[8-(1,2,3,4-tetrahydroisoquinolin-6-yl)-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2R,6S)-2-methyl-6-[[8-(1,2,3,4-tetrahydroisoquinolin-6-yl)-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146275872 |
| Molecular Formula | C31H36N6O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 5-[(2R,6S)-2-methyl-6-[[8-(1,2,3,4-tetrahydroisoquinolin-6-yl)-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CC3(C2)CN(c2ccc4c(c2)CCNC4)CCO3)O1 |
| InChI | InChI=1S/C31H36N6O2/c1-22-16-37(29-7-5-24(14-32)30-28(29)3-2-9-34-30)18-27(39-22)17-35-19-31(20-35)21-36(11-12-38-31)26-6-4-25-15-33-10-8-23(25)13-26/h2-7,9,13,22,27,33H,8,10-12,15-21H2,1H3/t22-,27+/m1/s1 |
| InChIKey | SGKDPIJZWCUIGU-AMGIVPHBSA-N |
| XLogP | 2.94 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|