C28H33N7O — CID 146275969
5-[(2R,6S)-2-methyl-6-[[4-(5,6,7,8-tetrahydro-2,7-naphthyridin-3-yl)piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 146275969) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is 5-[(2R,6S)-2-methyl-6-[[4-(5,6,7,8-tetrahydro-2,7-naphthyridin-3-yl)piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2R,6S)-2-methyl-6-[[4-(5,6,7,8-tetrahydro-2,7-naphthyridin-3-yl)piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146275969 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 5-[(2R,6S)-2-methyl-6-[[4-(5,6,7,8-tetrahydro-2,7-naphthyridin-3-yl)piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CCN(c3cc4c(cn3)CNCC4)CC2)O1 |
| InChI | InChI=1S/C28H33N7O/c1-20-17-35(26-5-4-22(14-29)28-25(26)3-2-7-31-28)19-24(36-20)18-33-9-11-34(12-10-33)27-13-21-6-8-30-15-23(21)16-32-27/h2-5,7,13,16,20,24,30H,6,8-12,15,17-19H2,1H3/t20-,24+/m1/s1 |
| InChIKey | MZDCJMNVNCIXTA-YKSBVNFPSA-N |
| XLogP | 2.56 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |