C30H37N7O — CID 146275710
5-[(2S,6R)-2-[[3,3-dimethyl-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)piperazin-1-yl]methyl]-6-methylmorpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 146275710) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is 5-[(2S,6R)-2-[[3,3-dimethyl-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)piperazin-1-yl]methyl]-6-methylmorpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2S,6R)-2-[[3,3-dimethyl-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)piperazin-1-yl]methyl]-6-methylmorpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146275710 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 5-[(2S,6R)-2-[[3,3-dimethyl-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)piperazin-1-yl]methyl]-6-methylmorpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CCN(c3cnc4c(c3)CNCC4)C(C)(C)C2)O1 |
| InChI | InChI=1S/C30H37N7O/c1-21-17-36(28-7-6-22(14-31)29-26(28)5-4-9-33-29)19-25(38-21)18-35-11-12-37(30(2,3)20-35)24-13-23-15-32-10-8-27(23)34-16-24/h4-7,9,13,16,21,25,32H,8,10-12,15,17-20H2,1-3H3/t21-,25+/m1/s1 |
| InChIKey | PPPFUCIYSGZTHZ-BWKNWUBXSA-N |
| XLogP | 3.34 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |