C30H35N7O — CID 146275919
5-[(2R,6S)-2-methyl-6-[[3-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)-3,7-diazabicyclo[4.2.0]octan-7-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 146275919) has the molecular formula C30H35N7O and a molecular weight of 509.66 g/mol. Its IUPAC name is 5-[(2R,6S)-2-methyl-6-[[3-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)-3,7-diazabicyclo[4.2.0]octan-7-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2R,6S)-2-methyl-6-[[3-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)-3,7-diazabicyclo[4.2.0]octan-7-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146275919 |
| Molecular Formula | C30H35N7O |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 5-[(2R,6S)-2-methyl-6-[[3-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-yl)-3,7-diazabicyclo[4.2.0]octan-7-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CC3CN(c4ccc5c(n4)CCNC5)CCC32)O1 |
| InChI | InChI=1S/C30H35N7O/c1-20-15-36(28-6-4-21(13-31)30-25(28)3-2-10-33-30)18-24(38-20)19-37-17-23-16-35(12-9-27(23)37)29-7-5-22-14-32-11-8-26(22)34-29/h2-7,10,20,23-24,27,32H,8-9,11-12,14-19H2,1H3/t20-,23?,24-,27?/m1/s1 |
| InChIKey | ZRLATQPYWWQYOK-NYWPNTHXSA-N |
| XLogP | 2.95 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |